On Target AA1R_HUMAN 0.2872928/CHEMBL596460
For the given ligand Methotrimeprazine, we have found in our database that, being scored 0.2872928, the most similar ligand is CHEMBL596460. Check out the elaboration below.
| Methotrimeprazine (Given Ligand) | CHEMBL596460 (Similar Ligand) |
|---|---|
| COc3ccc2sc1ccccc1n(C[C@H](C)CN(C)C)c2c3 | CNc1ncnc2c1ncn2[C@@H]3S[C@@H]([C@@H](O)[C@H]3O)C(=O)NC4CC4 |
|
|
|
|
|
|
| 00000000 43000400 20100100 08110500 00080000 00002000 00000000 20000000 04200000 020241e0 00200000 400b8000 00010006 05840000 00000000 00080008 04a00000 00000000 02c02000 00000201 40000000 10000010 010003c0 04300010 00000001 00000000 00004000 10000000 00000200 00040030 00000000 03012200 | 0205000a 43801800 a0180060 08180660 02190068 0300e000 20008001 20000800 00400100 02824080 0020900c 40071008 14019016 038c0300 04c80080 100cc00c 04040000 00004000 00c00020 80200201 80000000 10040676 278047c4 0410001c 28030003 00080030 00004400 100000f0 00021008 804e0021 c0080000 07012ac0 |