On Target AA1R_HUMAN 0.3809524/CHEMBL196375
For the given ligand Mesalazine, we have found in our database that, being scored 0.3809524, the most similar ligand is CHEMBL196375. Check out the elaboration below.
| Mesalazine (Given Ligand) | CHEMBL196375 (Similar Ligand) |
|---|---|
| Nc1ccc(O)c(C(=O)O)c1 | Nc1ccc2c(O)c(cnc2n1)C(=O)NCc3ccccc3 |
|
|
|
|
|
|
| 00000002 00000808 20000100 00010200 00000000 00024000 02000000 00000800 00000100 00000840 00000004 40008000 00008002 00000000 00000040 10082008 00000000 02000000 00000000 80020000 40000000 08020a20 20000000 00400004 00040000 80000000 00040000 00000000 00400000 00060000 c0000000 00000000 | 10000002 01808808 20004100 08010610 00041000 00024000 04004000 02001c00 00000100 00100840 41200004 40009000 00008802 00c00000 00000440 000c200c 00022000 0200000c 00200000 40260400 c0000000 0c068e28 20800800 8060000c 00040000 c0000000 08000080 80000000 00400108 00460001 c4040000 80280280 |