On Target AOFB_HUMAN 0.45783132/CHEMBL3769905
For the given ligand Mesalazine, we have found in our database that, being scored 0.45783132, the most similar ligand is CHEMBL3769905. Check out the elaboration below.
| Mesalazine (Given Ligand) | CHEMBL3769905 (Similar Ligand) |
|---|---|
| Nc1ccc(O)c(C(=O)O)c1 | CC(=O)c1ccc(OCc2cccc(c2)[N+](=O)[O-])cc1 |
|
|
|
|
|
|
| 00000002 00000808 20000100 00010200 00000000 00024000 02000000 00000800 00000100 00000840 00000004 40008000 00008002 00000000 00000040 10082008 00000000 02000000 00000000 80020000 40000000 08020a20 20000000 00400004 00040000 80000000 00040000 00000000 00400000 00060000 c0000000 00000000 | 04000002 00000818 2000410d 00010200 00001000 00004000 02040000 00000000 14000100 00080860 0c000004 40008000 00818002 00010000 21100141 02080018 00000000 02000000 00010000 80020000 40020000 08020220 20000000 00c01414 00040000 c0002000 00120000 00002000 00400200 00060002 c0000000 04000400 |