On Target NMDE2_HUMAN 0.2601156/CHEMBL218017
For the given ligand Sulfasalazine, we have found in our database that, being scored 0.2601156, the most similar ligand is CHEMBL218017. Check out the elaboration below.
| Sulfasalazine (Given Ligand) | CHEMBL218017 (Similar Ligand) |
|---|---|
| O=C(O)c3cc(/N=N/c2ccc(S(=O)(=O)Nc1ccccn1)cc2)ccc3O | O=C(OCc1ccccc1)N2CCC(CNc3ccccn3)CC2 |
|
|
|
|
|
|
| 00000012 00882808 61004102 00b10200 00050012 00024000 02000000 00000800 00000300 00040840 00002104 60008000 00048c02 08000001 80280050 102e200c 0000a000 02800000 00600000 80226001 c0000000 0e229a20 20840846 0860200c 00050480 c1000000 80040080 0400004c 00500408 20060000 c0000080 00010060 | 01004002 01401000 00104100 00010600 20040000 0000e000 00000000 20100000 00200300 200008c0 00200004 50038000 00008802 00010000 00020000 021e000c 00060000 02084400 08200880 00a00201 40100000 1c048c70 20800800 00700018 00000000 80002002 00000080 10200080 00008208 00060801 c0001000 00000200 |