On Target GRM5_HUMAN 0.2890625/CHEMBL3087513
For the given ligand Methotrimeprazine, we have found in our database that, being scored 0.2890625, the most similar ligand is CHEMBL3087513. Check out the elaboration below.
| Methotrimeprazine (Given Ligand) | CHEMBL3087513 (Similar Ligand) |
|---|---|
| COc3ccc2sc1ccccc1n(C[C@H](C)CN(C)C)c2c3 | COC(=O)N1C[C@@H]2CC[C@H]1C[C@@]2(O)C#Cc3cccc(C)c3 |
|
|
|
|
|
|
| 00000000 43000400 20100100 08110500 00080000 00002000 00000000 20000000 04200000 020241e0 00200000 400b8000 00010006 05840000 00000000 00080008 04a00000 00000000 02c02000 00000201 40000000 10000010 010003c0 04300010 00000001 00000000 00004000 10000000 00000200 00040030 00000000 03012200 | 00000200 01025000 00102902 00090600 00482101 00008000 00200000 20000000 00000200 000008c0 00200080 50018008 00008082 01801000 00000000 001b0008 04020200 02080000 02c02000 00000201 00000008 18940d50 01000881 02500019 00000005 80040002 00000000 10000000 00000200 00060201 80020804 00002200 |