On Target P2RX3_HUMAN 0.28448275/CHEMBL3926652
For the given ligand Mesalazine, we have found in our database that, being scored 0.28448275, the most similar ligand is CHEMBL3926652. Check out the elaboration below.
| Mesalazine (Given Ligand) | CHEMBL3926652 (Similar Ligand) |
|---|---|
| Nc1ccc(O)c(C(=O)O)c1 | CC(C)Oc1ccc(NC2=NC(=O)N(C(C)C)C(=O)N2Cc3ccc(C)cc3)cc1 |
|
|
|
|
|
|
| 00000002 00000808 20000100 00010200 00000000 00024000 02000000 00000800 00000100 00000840 00000004 40008000 00008002 00000000 00000040 10082008 00000000 02000000 00000000 80020000 40000000 08020a20 20000000 00400004 00040000 80000000 00040000 00000000 00400000 00060000 c0000000 00000000 | 04000006 00800008 20000108 02010700 01001000 00008002 02009200 00001808 04000100 00000860 0820000c 40049000 84808822 00400000 01200041 1008104c 00040040 12084000 08400008 10220000 c0000000 18008040 61004040 81600014 40000000 80000000 44048000 00040080 0500c208 00460000 c0040000 02000000 |