On Target P2RX3_HUMAN 0.3877551/CHEMBL3679792
For the given ligand Ketamine, we have found in our database that, being scored 0.3877551, the most similar ligand is CHEMBL3679792. Check out the elaboration below.
| Ketamine (Given Ligand) | CHEMBL3679792 (Similar Ligand) |
|---|---|
| CNC2(c1ccccc1Cl)CCCCC2=O | COCc1ccccc1C2C(C(=O)C(C)C)C(=O)C(=O)N2c3ccc(cc3)C4CCCC4 |
|
|
|
|
|
|
| 00018000 01000000 00100102 00010600 00000000 00000000 00000000 02001000 00200800 000808c0 08300000 4001b880 0700880c 00200000 40000000 00000000 80000000 02000000 02002000 00000001 00000d00 18008310 00000000 00500010 00002000 80000200 00000000 90000000 00000102 00060002 08066000 00020600 | 0003c002 01801800 02100102 50010600 20000000 00006410 01000000 2a001000 04100900 000808c0 08380004 5001f800 0e00880a 00318000 800204e0 02080008 00040000 02000001 08002018 00000201 c0120500 18048630 20016000 00500018 00001800 c0002681 00004000 90000080 00008303 01060003 60045020 00c00600 |