On Target DRD3_HUMAN 0.39130434/CHEMBL286494
For the given ligand Mesalazine, we have found in our database that, being scored 0.39130434, the most similar ligand is CHEMBL286494. Check out the elaboration below.
| Mesalazine (Given Ligand) | CHEMBL286494 (Similar Ligand) |
|---|---|
| Nc1ccc(O)c(C(=O)O)c1 | Cc1cc(O)c2C(=O)c3c(O)cc(O)c4c5c(O)cc(O)c6C(=O)c7c(O)cc(C)c8c1c2c(c34)c(c78)c56 |
|
|
|
|
|
|
| 00000002 00000808 20000100 00010200 00000000 00024000 02000000 00000800 00000100 00000840 00000004 40008000 00008002 00000000 00000040 10082008 00000000 02000000 00000000 80020000 40000000 08020a20 20000000 00400004 00040000 80000000 00040000 00000000 00400000 00060000 c0000000 00000000 | 00000001 40000808 20000101 40010200 00000001 00020000 02000000 01000200 00000100 00080840 08000000 40008800 00008002 00000000 00000000 00002008 00000000 02000000 00000000 00020a00 00000000 08020208 00000020 00400014 00000000 a0000000 001a0000 40000000 00000080 00020042 82000000 00000400 |