On Target MDR1_HUMAN 0.34343433/CHEMBL595995
For the given ligand Sulfasalazine, we have found in our database that, being scored 0.34343433, the most similar ligand is CHEMBL595995. Check out the elaboration below.
| Sulfasalazine (Given Ligand) | CHEMBL595995 (Similar Ligand) |
|---|---|
| O=C(O)c3cc(/N=N/c2ccc(S(=O)(=O)Nc1ccccn1)cc2)ccc3O | CN1CCN(CC1)C(C(=O)Nc2ccc(NS(=O)(=O)c3ccccc3)cc2C(=O)c4ccccc4)c5ccccc5 |
|
|
|
|
|
|
| 00000012 00882808 61004102 00b10200 00050012 00024000 02000000 00000800 00000300 00040840 00002104 60008000 00048c02 08000001 80280050 102e200c 0000a000 02800000 00600000 80226001 c0000000 0e229a20 20840846 0860200c 00050480 c1000000 80040080 0400004c 00500408 20060000 c0000080 00010060 | 18004012 00801800 01100122 04b10600 20000020 00090040 00000000 03081000 00c00000 00090a40 08282024 6000b000 03048c02 00102001 c02a1440 10020002 0024a000 02000001 08400000 00006000 c0100000 38268e00 20042062 8bc0001f 00040080 e0000000 00008010 c000108c 0c488582 20060003 80046000 20010660 |