On Target AGTR2_HUMAN 0.25603864/CHEMBL190286
For the given ligand Methotrimeprazine, we have found in our database that, being scored 0.25603864, the most similar ligand is CHEMBL190286. Check out the elaboration below.
| Methotrimeprazine (Given Ligand) | CHEMBL190286 (Similar Ligand) |
|---|---|
| COc3ccc2sc1ccccc1n(C[C@H](C)CN(C)C)c2c3 | CNC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]2CS[C@@H]3C[C@@](Cc4ccc(O)cc4)(NC(=O)[C@@H](NC(=O)C)C(C)C)C(=O)N23 |
|
|
|
|
|
|
| 00000000 43000400 20100100 08110500 00080000 00002000 00000000 20000000 04200000 020241e0 00200000 400b8000 00010006 05840000 00000000 00080008 04a00000 00000000 02c02000 00000201 40000000 10000010 010003c0 04300010 00000001 00000000 00004000 10000000 00000200 00040030 00000000 03012200 | 04020002 43003608 20164302 0db10650 04000240 02000010 02202020 2000000c 84500980 0a0f4be0 28308001 5007b800 0601e006 003c2901 85020000 004c000c 04001410 0e000200 00000018 40420309 60000d00 382c0600 21000303 97700018 00061a00 80000220 00124300 10000100 0c000004 0046003b 60004010 a3812680 |