On Target AGTR2_HUMAN 0.30212766/CHEMBL346728
For the given ligand Sulfasalazine, we have found in our database that, being scored 0.30212766, the most similar ligand is CHEMBL346728. Check out the elaboration below.
| Sulfasalazine (Given Ligand) | CHEMBL346728 (Similar Ligand) |
|---|---|
| O=C(O)c3cc(/N=N/c2ccc(S(=O)(=O)Nc1ccccn1)cc2)ccc3O | CCc1nc2c(C)cc(C)nc2n1Cc3ccc(cc3)c4ccccc4S(=O)(=O)NC(=O)C(c5ccccc5)c6ccccc6 |
|
|
|
|
|
|
| 00000012 00882808 61004102 00b10200 00050012 00024000 02000000 00000800 00000300 00040840 00002104 60008000 00048c02 08000001 80280050 102e200c 0000a000 02800000 00600000 80226001 c0000000 0e229a20 20840846 0860200c 00050480 c1000000 80040080 0400004c 00500408 20060000 c0000080 00010060 | 0000205a 20800a01 01184500 11b50610 040c0060 0000c008 00018000 01001000 90500108 104838d0 0800a00c 60819800 81089881 00908001 c03e00c0 0a0c000c 0a022080 02800004 04680000 50016400 c0000000 18008630 31800041 9950051c 02042004 e1000284 80008040 4000004c 04404485 2046084a c00c7004 200106e8 |