On Target OPRM_MOUSE 0.4814815/CHEMBL2017149
For the given ligand Ketamine, we have found in our database that, being scored 0.4814815, the most similar ligand is CHEMBL2017149. Check out the elaboration below.
| Ketamine (Given Ligand) | CHEMBL2017149 (Similar Ligand) |
|---|---|
| CNC2(c1ccccc1Cl)CCCCC2=O | Oc1ccc2CC34C[C@H](CCC3(CCN(CC5CC5)C4)c2c1)C(=O)NCc6ccccc6 |
|
|
|
|
|
|
| 00018000 01000000 00100102 00010600 00000000 00000000 00000000 02001000 00200800 000808c0 08300000 4001b880 0700880c 00200000 40000000 00000000 80000000 02000000 02002000 00000001 00000d00 18008310 00000000 00500010 00002000 80000200 00000000 90000000 00000102 00060002 08066000 00020600 | 00010000 43800208 20100102 00010600 00000000 40000002 02000000 22001001 00000800 000808c0 08300000 50019000 0400881a 01201000 00000420 02060008 00000000 02000000 02002000 00020201 80000100 18008630 00004000 00500018 00000000 c0000001 00120000 90000000 00000102 0006000b 20060000 00002600 |