On Target P2Y12_HUMAN 0.36893204/CHEMBL2402273
For the given ligand Sulfasalazine, we have found in our database that, being scored 0.36893204, the most similar ligand is CHEMBL2402273. Check out the elaboration below.
| Sulfasalazine (Given Ligand) | CHEMBL2402273 (Similar Ligand) |
|---|---|
| O=C(O)c3cc(/N=N/c2ccc(S(=O)(=O)Nc1ccccn1)cc2)ccc3O | CCOC(=O)c1cnc(N2CCN(CC2)C(=O)NS(=O)(=O)c3ccc(C)cc3)c(Cl)c1 |
|
|
|
|
|
|
| 00000012 00882808 61004102 00b10200 00050012 00024000 02000000 00000800 00000300 00040840 00002104 60008000 00048c02 08000001 80280050 102e200c 0000a000 02800000 00600000 80226001 c0000000 0e229a20 20840846 0860200c 00050480 c1000000 80040080 0400004c 00500408 20060000 c0000080 00010060 | 0000c012 10803800 012041a0 86b90e10 00041018 00004000 08000000 08403008 10000100 20002a40 00202004 e0008c00 0600a80a 0001a041 80200900 121c000c 02062010 12004004 08610008 00a06000 c0102000 2e058f40 20800820 0a61000e 00040c00 80002600 88080080 000004ac 0cc08618 20060801 c0001000 00030260 |