On Target P2Y12_HUMAN 0.37692308/CHEMBL88799
For the given ligand Ketamine, we have found in our database that, being scored 0.37692308, the most similar ligand is CHEMBL88799. Check out the elaboration below.
| Ketamine (Given Ligand) | CHEMBL88799 (Similar Ligand) |
|---|---|
| CNC2(c1ccccc1Cl)CCCCC2=O | Oc1nc2cc3cc(CCCCC(=O)NC45C[C@@H]6C[C@@H](C[C@@H](C6)C4)C5)ccc3[nH]c2n1 |
|
|
|
|
|
|
| 00018000 01000000 00100102 00010600 00000000 00000000 00000000 02001000 00200800 000808c0 08300000 4001b880 0700880c 00200000 40000000 00000000 80000000 02000000 02002000 00000001 00000d00 18008310 00000000 00500010 00002000 80000200 00000000 90000000 00000102 00060002 08066000 00020600 | 00014002 03005810 00184102 00010600 000c0040 0000c000 00008000 20000000 00400900 000808c0 08308004 40019000 0400880a 00e00000 60040140 000c000c 08000000 02000004 02202000 00000201 40020100 18048638 21800000 8050001c 00000000 80000000 00028040 10000000 00400002 00460003 c0060000 0c002680 |