On Target NOS2_HUMAN 0.4/CHEMBL114551
For the given ligand Methotrimeprazine, we have found in our database that, being scored 0.4, the most similar ligand is CHEMBL114551. Check out the elaboration below.
| Methotrimeprazine (Given Ligand) | CHEMBL114551 (Similar Ligand) |
|---|---|
| COc3ccc2sc1ccccc1n(C[C@H](C)CN(C)C)c2c3 | CC(=N)NCCSCC[C@H](N)C(=O)O |
|
|
|
|
|
|
| 00000000 43000400 20100100 08110500 00080000 00002000 00000000 20000000 04200000 020241e0 00200000 400b8000 00010006 05840000 00000000 00080008 04a00000 00000000 02c02000 00000201 40000000 10000010 010003c0 04300010 00000001 00000000 00004000 10000000 00000200 00040030 00000000 03012200 | 00000000 42000000 20000000 08100440 00000000 02002000 00000000 00000000 84000000 02004003 00200000 400c3000 04018006 00040000 00000000 00180008 04000000 00000000 00400000 00000081 40000000 10000a00 03200300 04000010 00000000 00000000 40004000 00000000 00000010 00040020 00000000 03010200 |