On Target NOS2_HUMAN 0.44210526/CHEMBL258348
For the given ligand Ketamine, we have found in our database that, being scored 0.44210526, the most similar ligand is CHEMBL258348. Check out the elaboration below.
| Ketamine (Given Ligand) | CHEMBL258348 (Similar Ligand) |
|---|---|
| CNC2(c1ccccc1Cl)CCCCC2=O | CN(Cc1cc(Cl)ccc1C(F)(F)F)C2CCN(C)CC2 |
|
|
|
|
|
|
| 00018000 01000000 00100102 00010600 00000000 00000000 00000000 02001000 00200800 000808c0 08300000 4001b880 0700880c 00200000 40000000 00000000 80000000 02000000 02002000 00000001 00000d00 18008310 00000000 00500010 00002000 80000200 00000000 90000000 00000102 00060002 08066000 00020600 | 00008000 09000400 00100100 10010600 00000000 00000000 04000400 02001000 00000000 000009f8 00200000 50018800 02000906 01200000 80000400 00000000 00000000 02000000 00002000 00000201 04020000 18008100 00000000 00500010 00002000 c0000000 00044000 90000000 00000100 00060010 20160000 00020200 |