On Target SCN9A_HUMAN 0.5858586/CHEMBL206758
For the given ligand Ketamine, we have found in our database that, being scored 0.5858586, the most similar ligand is CHEMBL206758. Check out the elaboration below.
| Ketamine (Given Ligand) | CHEMBL206758 (Similar Ligand) |
|---|---|
| CNC2(c1ccccc1Cl)CCCCC2=O | OC(CCc1ccccc1)[C@@H]2CCC[C@H]2C(=O)NCc3cc(Cl)cc(Cl)c3 |
|
|
|
|
|
|
| 00018000 01000000 00100102 00010600 00000000 00000000 00000000 02001000 00200800 000808c0 08300000 4001b880 0700880c 00200000 40000000 00000000 80000000 02000000 02002000 00000001 00000d00 18008310 00000000 00500010 00002000 80000200 00000000 90000000 00000102 00060002 08066000 00020600 | 00058000 09800000 00100102 00010600 00180000 00000020 04000000 22001000 00000800 000808c8 08300000 40019800 0600880e 00a00400 80000400 00080008 00000000 02000000 00402000 00000201 80000100 18008710 01000040 00500018 00002000 c0000000 00000000 90000000 00000102 01060003 20060000 00020e00 |