On Target PRGR_HUMAN 0.25409836/CHEMBL3765823
For the given ligand Methotrimeprazine, we have found in our database that, being scored 0.25409836, the most similar ligand is CHEMBL3765823. Check out the elaboration below.
| Methotrimeprazine (Given Ligand) | CHEMBL3765823 (Similar Ligand) |
|---|---|
| COc3ccc2sc1ccccc1n(C[C@H](C)CN(C)C)c2c3 | Cc1c(Cl)c(ccc1N[C@@H]2CCCC[C@@]2(C)O)C#N |
|
|
|
|
|
|
| 00000000 43000400 20100100 08110500 00080000 00002000 00000000 20000000 04200000 020241e0 00200000 400b8000 00010006 05840000 00000000 00080008 04a00000 00000000 02c02000 00000201 40000000 10000010 010003c0 04300010 00000001 00000000 00004000 10000000 00000200 00040030 00000000 03012200 | 0000c002 01000800 00101100 01010600 200800a1 00002040 08000000 00000100 00000000 008008c0 00200004 41018800 02000004 00808009 00020040 0008000a 00440000 02000000 0ae02000 00004001 40100000 18000110 23000400 00500010 00002000 80000200 08000000 10001080 00008000 00060400 00020000 00020200 |