On Target PRGR_HUMAN 0.45614034/CHEMBL1163480
For the given ligand Ketamine, we have found in our database that, being scored 0.45614034, the most similar ligand is CHEMBL1163480. Check out the elaboration below.
| Ketamine (Given Ligand) | CHEMBL1163480 (Similar Ligand) |
|---|---|
| CNC2(c1ccccc1Cl)CCCCC2=O | [O-][N+](=O)c1ccc(NC(CC(=O)c2ccc(Cl)cc2)C3CCCCC3)cc1 |
|
|
|
|
|
|
| 00018000 01000000 00100102 00010600 00000000 00000000 00000000 02001000 00200800 000808c0 08300000 4001b880 0700880c 00200000 40000000 00000000 80000000 02000000 02002000 00000001 00000d00 18008310 00000000 00500010 00002000 80000200 00000000 90000000 00000102 00060002 08066000 00020600 | 0001c002 01001a10 00100102 00010600 20000000 00002000 00000000 00000000 14000800 000808e0 0c300004 50019800 0e01802c 00200000 20120140 00040010 00040000 02000000 0a002010 00000001 40120100 18060310 20000000 00500014 00002000 c0000000 00040000 100000a0 02008002 0006000a 80020000 04020600 |