On Target CXCR1_HUMAN 0.21348314/CHEMBL3891755
For the given ligand Methotrimeprazine, we have found in our database that, being scored 0.21348314, the most similar ligand is CHEMBL3891755. Check out the elaboration below.
| Methotrimeprazine (Given Ligand) | CHEMBL3891755 (Similar Ligand) |
|---|---|
| COc3ccc2sc1ccccc1n(C[C@H](C)CN(C)C)c2c3 | COC(=O)[C@@H]1CCCN1C(=O)c2cccc(NC3=C(NC([C@H]4CCCS4)c5oc(C)cc5)C(=O)C3=O)c2F |
|
|
|
|
|
|
| 00000000 43000400 20100100 08110500 00080000 00002000 00000000 20000000 04200000 020241e0 00200000 400b8000 00010006 05840000 00000000 00080008 04a00000 00000000 02c02000 00000201 40000000 10000010 010003c0 04300010 00000001 00000000 00004000 10000000 00000200 00040030 00000000 03012200 | 1041c08a c3205800 e0180302 0a112700 24090081 08002818 800002a0 222d1500 05e04d40 071b48d0 00380034 5043b880 ce098c5f 41241008 800a9460 100801c8 16874601 22008c00 0863aa30 26000241 40100d80 18168e00 33000300 2658001c 04841030 c0000280 04d04010 9c0c0581 60588302 a006c023 a4045024 43012600 |