On Target DRD4_HUMAN 0.36607143/CHEMBL351611
For the given ligand Methotrimeprazine, we have found in our database that, being scored 0.36607143, the most similar ligand is CHEMBL351611. Check out the elaboration below.
| Methotrimeprazine (Given Ligand) | CHEMBL351611 (Similar Ligand) |
|---|---|
| COc3ccc2sc1ccccc1n(C[C@H](C)CN(C)C)c2c3 | C(Oc1ccccc1)[C@@H]2CC[C@H]3CN(CCN3C2)c4ccccc4 |
|
|
|
|
|
|
| 00000000 43000400 20100100 08110500 00080000 00002000 00000000 20000000 04200000 020241e0 00200000 400b8000 00010006 05840000 00000000 00080008 04a00000 00000000 02c02000 00000201 40000000 10000010 010003c0 04300010 00000001 00000000 00004000 10000000 00000200 00040030 00000000 03012200 | 04004002 01000008 20100128 04010700 20081000 02002000 02000000 20000000 00000000 00000ac0 00200004 50018000 00800002 01802000 11020041 00082008 00a40000 00000000 08c02000 00020201 40100000 38000010 210000a1 02100012 00000001 00000000 00000000 10000080 08008200 00060000 00000000 00002240 |