On Target PGH2_HUMAN 0.23529412/CHEMBL432260
For the given ligand Methotrimeprazine, we have found in our database that, being scored 0.23529412, the most similar ligand is CHEMBL432260. Check out the elaboration below.
| Methotrimeprazine (Given Ligand) | CHEMBL432260 (Similar Ligand) |
|---|---|
| COc3ccc2sc1ccccc1n(C[C@H](C)CN(C)C)c2c3 | COc1ccc2c(c1)c(CC(=O)N[C@@H](CO)CCSC)c(C)n2C(=O)c3ccc(Cl)cc3 |
|
|
|
|
|
|
| 00000000 43000400 20100100 08110500 00080000 00002000 00000000 20000000 04200000 020241e0 00200000 400b8000 00010006 05840000 00000000 00080008 04a00000 00000000 02c02000 00000201 40000000 10000010 010003c0 04300010 00000001 00000000 00004000 10000000 00000200 00040030 00000000 03012200 | 00008002 00005a08 20100188 51110758 000450a0 00002000 060c2000 00001000 84500080 000948c0 08200004 4009b800 13018866 00648000 c10a0041 020c000c 14811200 83800004 01680400 00020201 40000000 18228718 23804301 9150001c 00042000 c0000100 08160000 10000000 04000204 0006006b 80042200 01032620 |