On Target PGH2_HUMAN 0.43150684/CHEMBL405744
For the given ligand Sulfasalazine, we have found in our database that, being scored 0.43150684, the most similar ligand is CHEMBL405744. Check out the elaboration below.
| Sulfasalazine (Given Ligand) | CHEMBL405744 (Similar Ligand) |
|---|---|
| O=C(O)c3cc(/N=N/c2ccc(S(=O)(=O)Nc1ccccn1)cc2)ccc3O | NS(=O)(=O)c1ccc(cc1)\N=C\c2ccc(O)c(c2)C(=O)O |
|
|
|
|
|
|
| 00000012 00882808 61004102 00b10200 00050012 00024000 02000000 00000800 00000300 00040840 00002104 60008000 00048c02 08000001 80280050 102e200c 0000a000 02800000 00600000 80226001 c0000000 0e229a20 20840846 0860200c 00050480 c1000000 80040080 0400004c 00500408 20060000 c0000080 00010060 | 00000016 00842808 23000100 08b10200 00008011 00024000 12400410 00000800 00000100 00000841 00002004 60008010 00008002 40008001 802000c0 08082008 00000800 02000000 00000000 40022000 c0000000 08020a20 21000002 0840000c 00080000 88000000 40020400 00000048 00080008 20060000 c0000000 00010020 |