On Target TRY1_HUMAN 0.325/CHEMBL312647
For the given ligand Methotrimeprazine, we have found in our database that, being scored 0.325, the most similar ligand is CHEMBL312647. Check out the elaboration below.
| Methotrimeprazine (Given Ligand) | CHEMBL312647 (Similar Ligand) |
|---|---|
| COc3ccc2sc1ccccc1n(C[C@H](C)CN(C)C)c2c3 | CN([C@@H](CCC(=O)O)C(=O)N1CCCC[C@H]1CCOC2CCN(CC2)C(=N)N)C3CCCCC3 |
|
|
|
|
|
|
| 00000000 43000400 20100100 08110500 00080000 00002000 00000000 20000000 04200000 020241e0 00200000 400b8000 00010006 05840000 00000000 00080008 04a00000 00000000 02c02000 00000201 40000000 10000010 010003c0 04300010 00000001 00000000 00004000 10000000 00000200 00040030 00000000 03012200 | 00030040 01001000 00100100 04010d00 00180000 00000000 00000000 20002000 00000200 00020082 00200000 5001b000 06009032 01882000 80000000 00181008 00a00000 00000000 02c02000 00000201 00000020 30152e10 01000081 02100018 00000403 00000000 40000000 10000000 08000210 00040001 800a4000 00802a00 |