On Target TRY1_HUMAN 0.4556962/CHEMBL149324
For the given ligand Mesalazine, we have found in our database that, being scored 0.4556962, the most similar ligand is CHEMBL149324. Check out the elaboration below.
| Mesalazine (Given Ligand) | CHEMBL149324 (Similar Ligand) |
|---|---|
| Nc1ccc(O)c(C(=O)O)c1 | NC(=N)Nc1ccc(cc1)C(=O)Oc2ccccc2 |
|
|
|
|
|
|
| 00000002 00000808 20000100 00010200 00000000 00024000 02000000 00000800 00000100 00000840 00000004 40008000 00008002 00000000 00000040 10082008 00000000 02000000 00000000 80020000 40000000 08020a20 20000000 00400004 00040000 80000000 00040000 00000000 00400000 00060000 c0000000 00000000 | 04000002 00000818 20000108 80090a00 00001000 00004000 02000000 00002001 00000100 00000842 00200004 40008000 00808002 00018000 01010041 02080008 00060000 02000000 08000000 00020000 40020000 08020a20 30000000 00c01004 00100000 80002000 40000000 00000080 00008210 00060000 c0000000 14004000 |