On Target 5HT1B_HUMAN 0.3292683/CHEMBL110317
For the given ligand Mesalazine, we have found in our database that, being scored 0.3292683, the most similar ligand is CHEMBL110317. Check out the elaboration below.
| Mesalazine (Given Ligand) | CHEMBL110317 (Similar Ligand) |
|---|---|
| Nc1ccc(O)c(C(=O)O)c1 | CC(=O)c1ccc2[nH]cc(CCN)c2c1 |
|
|
|
|
|
|
| 00000002 00000808 20000100 00010200 00000000 00024000 02000000 00000800 00000100 00000840 00000004 40008000 00008002 00000000 00000040 10082008 00000000 02000000 00000000 80020000 40000000 08020a20 20000000 00400004 00040000 80000000 00040000 00000000 00400000 00060000 c0000000 00000000 | 00000002 00004800 00000100 41010610 00041000 00000000 00002000 00000000 00400100 00090840 08000004 40008800 10008800 00400000 00000040 00040004 00000000 02000004 00200400 00000000 40000000 18068208 20800000 81400014 00042000 80000000 08000040 00000000 04400000 00060002 80040200 00000420 |