On Target 5HT1B_HUMAN 0.4090909/CHEMBL191460
For the given ligand Ketamine, we have found in our database that, being scored 0.4090909, the most similar ligand is CHEMBL191460. Check out the elaboration below.
| Ketamine (Given Ligand) | CHEMBL191460 (Similar Ligand) |
|---|---|
| CNC2(c1ccccc1Cl)CCCCC2=O | CN(C)CCN(Cc1ccc(cc1)c2ccc(CNCCc3ccccc3)cc2)C(=O)CCC4CCCC4.OC(=O)C(F)(F)F.OC(=O)C(F)(F)F |
|
|
|
|
|
|
| 00018000 01000000 00100102 00010600 00000000 00000000 00000000 02001000 00200800 000808c0 08300000 4001b880 0700880c 00200000 40000000 00000000 80000000 02000000 02002000 00000001 00000d00 18008310 00000000 00500010 00002000 80000200 00000000 90000000 00000102 00060002 08066000 00020600 | 00012000 01802000 00100100 04010600 00000000 00000000 00000000 22001008 00000180 000908c0 08200000 40019000 8400880a 00002000 00000400 00080008 00020000 02000000 04002000 10000205 80000000 38208e10 10000001 83500018 00000000 c0000000 00000000 90000040 0c004100 01060003 20060000 00000600 |