On Target OPRD_HUMAN 0.36363637/CHEMBL416930
For the given ligand Mesalazine, we have found in our database that, being scored 0.36363637, the most similar ligand is CHEMBL416930. Check out the elaboration below.
| Mesalazine (Given Ligand) | CHEMBL416930 (Similar Ligand) |
|---|---|
| Nc1ccc(O)c(C(=O)O)c1 | CCN(CC)C(=O)c1ccc(cc1)C(N2CCN(CC2)c3ccc(O)cc3)c4ccccc4 |
|
|
|
|
|
|
| 00000002 00000808 20000100 00010200 00000000 00024000 02000000 00000800 00000100 00000840 00000004 40008000 00008002 00000000 00000040 10082008 00000000 02000000 00000000 80020000 40000000 08020a20 20000000 00400004 00040000 80000000 00040000 00000000 00400000 00060000 c0000000 00000000 | 00004002 00000808 20000120 44010600 00000000 00000000 02000000 03001000 00000100 00090a40 08200004 40008800 80008822 00002000 00000440 00000008 00040000 02000000 08000000 00020000 40100000 28028600 20000020 0240001e 00000000 e0000000 00040000 c0000080 08008180 00060003 80040000 00000600 |