On Target CXCR4_HUMAN 0.2736842/CHEMBL126657
For the given ligand Mesalazine, we have found in our database that, being scored 0.2736842, the most similar ligand is CHEMBL126657. Check out the elaboration below.
| Mesalazine (Given Ligand) | CHEMBL126657 (Similar Ligand) |
|---|---|
| Nc1ccc(O)c(C(=O)O)c1 | COc1cc(\C=C\C(=O)c2ccc(Cl)cc2)ccc1O |
|
|
|
|
|
|
| 00000002 00000808 20000100 00010200 00000000 00024000 02000000 00000800 00000100 00000840 00000004 40008000 00008002 00000000 00000040 10082008 00000000 02000000 00000000 80020000 40000000 08020a20 20000000 00400004 00040000 80000000 00040000 00000000 00400000 00060000 c0000000 00000000 | 00008000 40000808 20000308 00010200 00001000 00800000 82000081 00000400 01800000 00b80840 08000000 40108800 0200c026 00000000 01000003 00008008 00000400 02100000 00098000 00020a00 00000000 08020300 00008001 00400014 01002000 80000000 00462000 40000000 00400200 00020102 84000000 00020500 |