On Target NTRK1_HUMAN 0.4347826/CHEMBL2152285
For the given ligand Sulfasalazine, we have found in our database that, being scored 0.4347826, the most similar ligand is CHEMBL2152285. Check out the elaboration below.
| Sulfasalazine (Given Ligand) | CHEMBL2152285 (Similar Ligand) |
|---|---|
| O=C(O)c3cc(/N=N/c2ccc(S(=O)(=O)Nc1ccccn1)cc2)ccc3O | Nc1cc(NS(=O)(=O)c2ccccc2)cc(c1)c3cnc4[nH]cc(c5ccncc5)c4c3 |
|
|
|
|
|
|
| 00000012 00882808 61004102 00b10200 00050012 00024000 02000000 00000800 00000300 00040840 00002104 60008000 00048c02 08000001 80280050 102e200c 0000a000 02800000 00600000 80226001 c0000000 0e229a20 20840846 0860200c 00050480 c1000000 80040080 0400004c 00500408 20060000 c0000080 00010060 | 00002012 00800800 01004302 00b10210 000c1000 04004008 00000000 00000000 00000100 00000840 01002004 60008000 80040c00 00c00001 80281040 800e0004 00022000 02000404 04600000 50106002 c0000000 08028820 30840040 88400018 000c0081 80080000 08000240 0000004c 00c14406 20460000 40040200 000104e0 |