On Target NTRK1_HUMAN 0.37068966/CHEMBL1982413
For the given ligand Ketamine, we have found in our database that, being scored 0.37068966, the most similar ligand is CHEMBL1982413. Check out the elaboration below.
| Ketamine (Given Ligand) | CHEMBL1982413 (Similar Ligand) |
|---|---|
| CNC2(c1ccccc1Cl)CCCCC2=O | CN(Cc1cc(Cl)c(O)c2ncccc12)C3CCCCC3 |
|
|
|
|
|
|
| 00018000 01000000 00100102 00010600 00000000 00000000 00000000 02001000 00200800 000808c0 08300000 4001b880 0700880c 00200000 40000000 00000000 80000000 02000000 02002000 00000001 00000d00 18008310 00000000 00500010 00002000 80000200 00000000 90000000 00000102 00060002 08066000 00020600 | 00018002 09000808 60104100 00010600 000c0000 00000004 06000000 22201000 00000000 000008c8 00200004 40018800 82000806 00400000 80000440 0004000c 00000008 02000000 02202000 00020201 40000000 18008118 20800000 80500010 00006400 c0000800 00220040 90000000 00000100 00060000 20048000 00420220 |