On Target MTOR_HUMAN 0.31355932/CHEMBL1667869
For the given ligand Mesalazine, we have found in our database that, being scored 0.31355932, the most similar ligand is CHEMBL1667869. Check out the elaboration below.
| Mesalazine (Given Ligand) | CHEMBL1667869 (Similar Ligand) |
|---|---|
| Nc1ccc(O)c(C(=O)O)c1 | Cc1nc(N)c2cccc(C(=O)Nc3cn[nH]c3)c2n1 |
|
|
|
|
|
|
| 00000002 00000808 20000100 00010200 00000000 00024000 02000000 00000800 00000100 00000840 00000004 40008000 00008002 00000000 00000040 10082008 00000000 02000000 00000000 80020000 40000000 08020a20 20000000 00400004 00040000 80000000 00040000 00000000 00400000 00060000 c0000000 00000000 | 10000002 81008808 20000102 98090630 01040020 00004000 0000d000 02001800 10000100 80000850 41280004 4000d000 00008800 00600000 000200c1 020c000c 00000080 02000004 01600000 40222000 c0100000 08068e28 20810840 0040010c 00840002 80000000 00000000 80000080 0040010c 00460003 c0040000 800002e0 |