On Target MTOR_HUMAN 0.31284916/CHEMBL4100500
For the given ligand Ketamine, we have found in our database that, being scored 0.31284916, the most similar ligand is CHEMBL4100500. Check out the elaboration below.
| Ketamine (Given Ligand) | CHEMBL4100500 (Similar Ligand) |
|---|---|
| CNC2(c1ccccc1Cl)CCCCC2=O | Oc1ccc(CCC(=O)N(C(C(=O)NCc2ccccc2)c3ccc(OCCNCCOCCOCCNC(=O)CCCC[C@@H]4SC[C@@H]5NC(=O)N[C@H]45)cc3)C6CC6)cc1 |
|
|
|
|
|
|
| 00018000 01000000 00100102 00010600 00000000 00000000 00000000 02001000 00200800 000808c0 08300000 4001b880 0700880c 00200000 40000000 00000000 80000000 02000000 02002000 00000001 00000d00 18008310 00000000 00500010 00002000 80000200 00000000 90000000 00000102 00060002 08066000 00020600 | 04012000 47807208 20100108 84110e42 00001080 00000000 02040004 22003048 04202880 020948c0 08300000 4007b000 0781980e 01042100 c1281409 000d0008 14001000 02002000 00002068 00020301 c0000100 38258610 16000301 8b700018 00010c00 c0000000 00b24000 90000021 0c000300 0006002b 200e6000 03012600 |