On Target OPRX_HUMAN 0.6666667/CHEMBL512414
For the given ligand Ketamine, we have found in our database that, being scored 0.6666667, the most similar ligand is CHEMBL512414. Check out the elaboration below.
| Ketamine (Given Ligand) | CHEMBL512414 (Similar Ligand) |
|---|---|
| CNC2(c1ccccc1Cl)CCCCC2=O | NC(=O)C1(CC2CCC(C1)N2C(c3ccccc3Cl)c4ccccc4Cl)c5ccccc5 |
|
|
|
|
|
|
| 00018000 01000000 00100102 00010600 00000000 00000000 00000000 02001000 00200800 000808c0 08300000 4001b880 0700880c 00200000 40000000 00000000 80000000 02000000 02002000 00000001 00000d00 18008310 00000000 00500010 00002000 80000200 00000000 90000000 00000102 00060002 08066000 00020600 | 00038000 01000200 00100102 00010600 00000000 00000010 00000000 23001000 00200800 800808c0 08300000 50039800 0700880e 00200000 40000400 00040000 00000000 02000000 00002000 00000201 00000d00 18008710 00000000 81500010 00002000 e0000200 00000000 d0001180 04000182 0006000a 2c062000 00822600 |