On Target FYN_HUMAN 0.41095892/CHEMBL1975923
For the given ligand Mesalazine, we have found in our database that, being scored 0.41095892, the most similar ligand is CHEMBL1975923. Check out the elaboration below.
| Mesalazine (Given Ligand) | CHEMBL1975923 (Similar Ligand) |
|---|---|
| Nc1ccc(O)c(C(=O)O)c1 | CC(CCC(=O)O)(c1ccc(O)c(N)c1)c2ccc(O)c(N)c2 |
|
|
|
|
|
|
| 00000002 00000808 20000100 00010200 00000000 00024000 02000000 00000800 00000100 00000840 00000004 40008000 00008002 00000000 00000040 10082008 00000000 02000000 00000000 80020000 40000000 08020a20 20000000 00400004 00040000 80000000 00040000 00000000 00400000 00060000 c0000000 00000000 | 08010002 01000008 20000102 00010200 00080000 00000000 02000000 01000000 00400800 00080840 08100004 40009000 04008002 00200800 00000040 00084008 00000000 02000000 00400000 00020001 40000100 08000a00 21000000 00400010 00040000 a0000000 00120000 40000000 00400080 00060002 00000000 00400400 |