On Target CAH2_HUMAN 0.30927834/CHEMBL3400807
For the given ligand Methotrimeprazine, we have found in our database that, being scored 0.30927834, the most similar ligand is CHEMBL3400807. Check out the elaboration below.
| Methotrimeprazine (Given Ligand) | CHEMBL3400807 (Similar Ligand) |
|---|---|
| COc3ccc2sc1ccccc1n(C[C@H](C)CN(C)C)c2c3 | [Na+].[Na+].[O-]C(=O)[C@@H]1CCCN(C1)C(=S)[S-] |
|
|
|
|
|
|
| 00000000 43000400 20100100 08110500 00080000 00002000 00000000 20000000 04200000 020241e0 00200000 400b8000 00010006 05840000 00000000 00080008 04a00000 00000000 02c02000 00000201 40000000 10000010 010003c0 04300010 00000001 00000000 00004000 10000000 00000200 00040030 00000000 03012200 | 00010000 01000000 00104000 00100400 00080000 00000000 00000000 20000000 00000400 00000080 00200000 50011000 0c00a012 410c0000 00000000 00080008 00050050 00000200 00c00010 00040201 00000000 10000a00 01000080 00100010 00001001 00000000 00000000 10000000 00200000 00040000 00000000 00012a08 |