On Target CDK5_HUMAN 0.40875912/CHEMBL2004892
For the given ligand Sulfasalazine, we have found in our database that, being scored 0.40875912, the most similar ligand is CHEMBL2004892. Check out the elaboration below.
| Sulfasalazine (Given Ligand) | CHEMBL2004892 (Similar Ligand) |
|---|---|
| O=C(O)c3cc(/N=N/c2ccc(S(=O)(=O)Nc1ccccn1)cc2)ccc3O | CS(=O)(=O)Nc1ccc(cc1)c2ccc3[nH]nc(N)c3c2 |
|
|
|
|
|
|
| 00000012 00882808 61004102 00b10200 00050012 00024000 02000000 00000800 00000300 00040840 00002104 60008000 00048c02 08000001 80280050 102e200c 0000a000 02800000 00600000 80226001 c0000000 0e229a20 20840846 0860200c 00050480 c1000000 80040080 0400004c 00500408 20060000 c0000080 00010060 | 00002003 00000808 20000102 00310200 00040000 00000000 02000000 00000000 00000000 10000840 00002004 40008000 00000402 00400001 80080040 0006400c 00020000 02000004 04600000 00224202 40000000 0c020808 30800800 00600000 00120080 80000000 00040000 0000004c 00004008 00060000 00000000 00014060 |