On Target CDK5_HUMAN 0.42857143/CHEMBL1986666
For the given ligand Mesalazine, we have found in our database that, being scored 0.42857143, the most similar ligand is CHEMBL1986666. Check out the elaboration below.
| Mesalazine (Given Ligand) | CHEMBL1986666 (Similar Ligand) |
|---|---|
| Nc1ccc(O)c(C(=O)O)c1 | OC(=O)c1ccccc1Nc2ncnc(Nc3ccc4cn[nH]c4c3)n2 |
|
|
|
|
|
|
| 00000002 00000808 20000100 00010200 00000000 00024000 02000000 00000800 00000100 00000840 00000004 40008000 00008002 00000000 00000040 10082008 00000000 02000000 00000000 80020000 40000000 08020a20 20000000 00400004 00040000 80000000 00040000 00000000 00400000 00060000 c0000000 00000000 | 00000202 00000808 20000100 00010200 02040000 00014000 02000000 00000880 00800100 00000840 00200004 40009000 04008023 00400000 00020040 100c000c 00041000 12004000 08610018 10220000 40080000 0c020a28 61804800 00600004 00100000 80000000 00040080 000010c0 00008008 00460000 c0000000 00004060 |