On Target ESR1_HUMAN 0.4015748/CHEMBL1627354
For the given ligand Methotrimeprazine, we have found in our database that, being scored 0.4015748, the most similar ligand is CHEMBL1627354. Check out the elaboration below.
| Methotrimeprazine (Given Ligand) | CHEMBL1627354 (Similar Ligand) |
|---|---|
| COc3ccc2sc1ccccc1n(C[C@H](C)CN(C)C)c2c3 | CCCCN(C)C(=O)CCCCCCCCCCS[C@@H]1Cc2cc(O)ccc2[C@H]3CC[C@]4(C)[C@@H](O)CC[C@H]4[C@H]13 |
|
|
|
|
|
|
| 00000000 43000400 20100100 08110500 00080000 00002000 00000000 20000000 04200000 020241e0 00200000 400b8000 00010006 05840000 00000000 00080008 04a00000 00000000 02c02000 00000201 40000000 10000010 010003c0 04300010 00000001 00000000 00004000 10000000 00000200 00040030 00000000 03012200 | 00010000 43001408 20100102 00110600 00080040 40000802 02000000 20000001 04a00800 010948c0 08300000 40039000 0401800a 00a40000 00000020 00080008 04000600 02000000 0240a000 00020201 60000100 18840610 01004304 02700018 00000000 80000001 00120000 14000000 00000002 01060833 00020000 01012600 |