On Target ESR1_HUMAN 0.44117647/CHEMBL1222035
For the given ligand Ketamine, we have found in our database that, being scored 0.44117647, the most similar ligand is CHEMBL1222035. Check out the elaboration below.
| Ketamine (Given Ligand) | CHEMBL1222035 (Similar Ligand) |
|---|---|
| CNC2(c1ccccc1Cl)CCCCC2=O | CCCCN(C)C(=O)CCCCCCCCCC[C@@H]1Cc2cc(O)ccc2[C@H]3CC[C@]4(C)[C@@H](O)CC[C@H]4[C@H]13 |
|
|
|
|
|
|
| 00018000 01000000 00100102 00010600 00000000 00000000 00000000 02001000 00200800 000808c0 08300000 4001b880 0700880c 00200000 40000000 00000000 80000000 02000000 02002000 00000001 00000d00 18008310 00000000 00500010 00002000 80000200 00000000 90000000 00000102 00060002 08066000 00020600 | 00010000 43001008 20100102 00010600 00080000 40000002 02000000 20000001 00000800 000808c0 08300000 40019000 0400800a 00a00000 00000020 00080008 00000200 02000000 02402000 00020201 00000100 18040610 01004000 00500018 00000000 80000001 00120000 10000000 00000002 01060003 00020000 00002600 |