On Target 5HT2C_HUMAN 0.3253012/CHEMBL194588
For the given ligand Mesalazine, we have found in our database that, being scored 0.3253012, the most similar ligand is CHEMBL194588. Check out the elaboration below.
| Mesalazine (Given Ligand) | CHEMBL194588 (Similar Ligand) |
|---|---|
| Nc1ccc(O)c(C(=O)O)c1 | CN(C)Cc1c[nH]c2cccc(O)c12 |
|
|
|
|
|
|
| 00000002 00000808 20000100 00010200 00000000 00024000 02000000 00000800 00000100 00000840 00000004 40008000 00008002 00000000 00000040 10082008 00000000 02000000 00000000 80020000 40000000 08020a20 20000000 00400004 00040000 80000000 00040000 00000000 00400000 00060000 c0000000 00000000 | 10000002 44000808 20000100 00010610 00041000 00000000 06004000 02001000 00000000 00000840 01200004 40008000 00000806 00400000 00000040 0004000c 00000008 02000004 00200000 00060000 40000000 08008808 20800000 80440000 00046000 80000000 08000000 80000000 00000100 00060000 00048200 80200220 |