On Target 5HT2C_HUMAN 0.56842107/CHEMBL1092029
For the given ligand Ketamine, we have found in our database that, being scored 0.56842107, the most similar ligand is CHEMBL1092029. Check out the elaboration below.
| Ketamine (Given Ligand) | CHEMBL1092029 (Similar Ligand) |
|---|---|
| CNC2(c1ccccc1Cl)CCCCC2=O | O=C(NCc1ccc(cc1)C2CCCCC2)[C@@H]3CCCN3 |
|
|
|
|
|
|
| 00018000 01000000 00100102 00010600 00000000 00000000 00000000 02001000 00200800 000808c0 08300000 4001b880 0700880c 00200000 40000000 00000000 80000000 02000000 02002000 00000001 00000d00 18008310 00000000 00500010 00002000 80000200 00000000 90000000 00000102 00060002 08066000 00020600 | 00010000 01800000 00100102 04010600 00000000 00000010 00000000 22001000 00000900 000908c0 08300000 4001b800 86008812 00202000 80000400 00000000 00000000 02000000 02002000 00000201 80000100 38008620 00000001 02500018 00000000 c0000000 00000000 90000000 08000102 00060003 20064000 00000600 |