On Target PTGES_HUMAN 0.31858408/CHEMBL3919693
For the given ligand Methotrimeprazine, we have found in our database that, being scored 0.31858408, the most similar ligand is CHEMBL3919693. Check out the elaboration below.
| Methotrimeprazine (Given Ligand) | CHEMBL3919693 (Similar Ligand) |
|---|---|
| COc3ccc2sc1ccccc1n(C[C@H](C)CN(C)C)c2c3 | CC1(C)CN(CC[C@H]1C(=O)N[C@H]2CCC[C@H](CO)C2)c3ccc(cc3)C(F)(F)F |
|
|
|
|
|
|
| 00000000 43000400 20100100 08110500 00080000 00002000 00000000 20000000 04200000 020241e0 00200000 400b8000 00010006 05840000 00000000 00080008 04a00000 00000000 02c02000 00000201 40000000 10000010 010003c0 04300010 00000001 00000000 00004000 10000000 00000200 00040030 00000000 03012200 | 00024002 01001800 00100100 00010600 20180000 00002000 00000400 20000000 00200000 000008d0 00200004 50039000 04008002 01808000 00020040 00080008 00040000 02000000 0a402000 00000201 40100000 18040610 21000000 00500018 00000000 80000000 00000200 90000080 00008000 00060001 00120000 00802a00 |