On Target PTGES_HUMAN 0.43373495/CHEMBL3092270
For the given ligand Sulfasalazine, we have found in our database that, being scored 0.43373495, the most similar ligand is CHEMBL3092270. Check out the elaboration below.
| Sulfasalazine (Given Ligand) | CHEMBL3092270 (Similar Ligand) |
|---|---|
| O=C(O)c3cc(/N=N/c2ccc(S(=O)(=O)Nc1ccccn1)cc2)ccc3O | OC(=O)c1ccc(cc1)S(=O)(=O)N(Cc2ccccc2)c3ccc(Oc4ccccc4)cc3 |
|
|
|
|
|
|
| 00000012 00882808 61004102 00b10200 00050012 00024000 02000000 00000800 00000300 00040840 00002104 60008000 00048c02 08000001 80280050 102e200c 0000a000 02800000 00600000 80226001 c0000000 0e229a20 20840846 0860200c 00050480 c1000000 80040080 0400004c 00500408 20060000 c0000080 00010060 | 00004012 00801808 2108010a 01b10600 00081008 00004000 06000001 02001008 00000100 00001840 00302004 6000c000 00048c22 00000001 81280041 000a0008 00042000 02100001 08402000 00026000 c0500000 08128a20 20050040 0940000c 02000080 80000004 40040000 802000ac 00008700 20060000 c0040400 00010360 |