On Target PTGES_HUMAN 0.4108527/CHEMBL4102262
For the given ligand Ketamine, we have found in our database that, being scored 0.4108527, the most similar ligand is CHEMBL4102262. Check out the elaboration below.
| Ketamine (Given Ligand) | CHEMBL4102262 (Similar Ligand) |
|---|---|
| CNC2(c1ccccc1Cl)CCCCC2=O | OC(=O)c1ccc(Cl)cc1CC[C@@H]2CCC[C@@H]2NC(=O)C3CCN(CC3)c4ccc(cc4)C(F)(F)F |
|
|
|
|
|
|
| 00018000 01000000 00100102 00010600 00000000 00000000 00000000 02001000 00200800 000808c0 08300000 4001b880 0700880c 00200000 40000000 00000000 80000000 02000000 02002000 00000001 00000d00 18008310 00000000 00500010 00002000 80000200 00000000 90000000 00000102 00060002 08066000 00020600 | 0002c002 05001800 00100102 00010600 20000000 0000e000 04000400 20000000 00300900 000808d0 08300004 50039800 06008086 01208000 80020060 00080008 00040000 02000000 08002000 00000201 40500500 18060f70 20004000 0054001c 00002000 80000201 00040200 90000080 00008002 01060003 c0120000 00822600 |