On Target MIF_HUMAN 0.36842105/CHEMBL224086
For the given ligand Mesalazine, we have found in our database that, being scored 0.36842105, the most similar ligand is CHEMBL224086. Check out the elaboration below.
| Mesalazine (Given Ligand) | CHEMBL224086 (Similar Ligand) |
|---|---|
| Nc1ccc(O)c(C(=O)O)c1 | COc1ccc(N\N=C\c2ccc(O)cc2)cc1 |
|
|
|
|
|
|
| 00000002 00000808 20000100 00010200 00000000 00024000 02000000 00000800 00000100 00000840 00000004 40008000 00008002 00000000 00000040 10082008 00000000 02000000 00000000 80020000 40000000 08020a20 20000000 00400004 00040000 80000000 00040000 00000000 00400000 00060000 c0000000 00000000 | 0000200a 00000008 20000108 00030200 00001000 04000000 02000000 01004008 00000100 00000841 00000004 40008000 80000042 00000000 01010041 00084008 00000000 02000000 00000400 00220000 40080000 0c000000 70040802 00600000 00000000 80000800 40060000 00000000 00000208 000e0000 40000000 00000000 |