On Target MIF_HUMAN 0.29113925/CHEMBL554271
For the given ligand Ketamine, we have found in our database that, being scored 0.29113925, the most similar ligand is CHEMBL554271. Check out the elaboration below.
| Ketamine (Given Ligand) | CHEMBL554271 (Similar Ligand) |
|---|---|
| CNC2(c1ccccc1Cl)CCCCC2=O | Oc1ccc(cc1F)C2=NOC(CCN3C(=O)c4ccccc4C3=O)C2 |
|
|
|
|
|
|
| 00018000 01000000 00100102 00010600 00000000 00000000 00000000 02001000 00200800 000808c0 08300000 4001b880 0700880c 00200000 40000000 00000000 80000000 02000000 02002000 00000001 00000d00 18008310 00000000 00500010 00002000 80000200 00000000 90000000 00000102 00060002 08066000 00020600 | 00000000 01801808 20900102 12050e00 02000000 10048010 020000c0 22003000 00108948 000828c1 08310000 50018000 80008802 00201000 00000408 00090018 00002800 02000000 00d06000 00820601 80020100 38168690 010010c2 0050001c 00000001 c0220004 e0124000 92000001 0018c10a 00068003 e00c0000 00000600 |