On Target HRH1_HUMAN 0.39805827/CHEMBL2158823
For the given ligand Mesalazine, we have found in our database that, being scored 0.39805827, the most similar ligand is CHEMBL2158823. Check out the elaboration below.
| Mesalazine (Given Ligand) | CHEMBL2158823 (Similar Ligand) |
|---|---|
| Nc1ccc(O)c(C(=O)O)c1 | OC(=O)c1cccc(c1)N2CCC(CN3CCC(CC3)Oc4ccc(Cl)c(Cl)c4)CC2 |
|
|
|
|
|
|
| 00000002 00000808 20000100 00010200 00000000 00024000 02000000 00000800 00000100 00000840 00000004 40008000 00008002 00000000 00000040 10082008 00000000 02000000 00000000 80020000 40000000 08020a20 20000000 00400004 00040000 80000000 00040000 00000000 00400000 00060000 c0000000 00000000 | 0400c002 01000808 60100108 00010600 20001000 02006000 92000000 20000000 00200100 000008d0 00200004 50038800 02808006 00000002 01020043 10082008 00240000 02000400 08800000 80020201 40100000 18020b20 21000080 00500014 00042001 80100000 00100000 10000080 20428200 00060000 c0000000 00022240 |