On Target NMDE1_HUMAN 0.16/CHEMBL2333945
For the given ligand Mesalazine, we have found in our database that, being scored 0.16, the most similar ligand is CHEMBL2333945. Check out the elaboration below.
| Mesalazine (Given Ligand) | CHEMBL2333945 (Similar Ligand) |
|---|---|
| Nc1ccc(O)c(C(=O)O)c1 | Fc1ccc(cc1Cl)S(=O)(=O)NCc2ccc(cc2)C(=O)NNC(=O)c3ccccc3 |
|
|
|
|
|
|
| 00000002 00000808 20000100 00010200 00000000 00024000 02000000 00000800 00000100 00000840 00000004 40008000 00008002 00000000 00000040 10082008 00000000 02000000 00000000 80020000 40000000 08020a20 20000000 00400004 00040000 80000000 00040000 00000000 00400000 00060000 c0000000 00000000 | 00008014 08808800 01180100 43b10600 00080000 00000010 04000801 00001000 00000100 40001848 40102000 60008800 82008804 00201201 a0200000 00000004 00002000 02100000 04400000 00006000 80000000 08028702 40000000 0840000c 02002000 80101004 40000000 0000000d 00000400 204e8002 80040000 001703e0 |