On Target NMDE1_HUMAN 0.32407406/CHEMBL284237
For the given ligand Ketamine, we have found in our database that, being scored 0.32407406, the most similar ligand is CHEMBL284237. Check out the elaboration below.
| Ketamine (Given Ligand) | CHEMBL284237 (Similar Ligand) |
|---|---|
| CNC2(c1ccccc1Cl)CCCCC2=O | C[C@]12N[C@H](Cc3ccccc13)c4ccccc24 |
|
|
|
|
|
|
| 00018000 01000000 00100102 00010600 00000000 00000000 00000000 02001000 00200800 000808c0 08300000 4001b880 0700880c 00200000 40000000 00000000 80000000 02000000 02002000 00000001 00000d00 18008310 00000000 00500010 00002000 80000200 00000000 90000000 00000102 00060002 08066000 00020600 | 00000008 00000000 00100100 10010600 00000020 00000002 00000400 03001001 04000880 00080840 08300000 40808000 00000802 00200000 00000400 00000080 00002000 02000020 00100000 00000201 00020100 18308000 00404000 81400810 00000000 e0200001 00004000 c0000000 06000180 00860002 20040000 00000700 |